C21H26N4O3 — CID 68811608
2,4-bis[(dimethylamino)methyl]-5-hydroxy-1-methyl-6-pyridin-3-ylindole-3-carboxylic acid (PubChem CID 68811608) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is 2,4-bis[(dimethylamino)methyl]-5-hydroxy-1-methyl-6-pyridin-3-ylindole-3-carboxylic acid.
| Compound Name | 2,4-bis[(dimethylamino)methyl]-5-hydroxy-1-methyl-6-pyridin-3-ylindole-3-carboxylic acid |
|---|---|
| PubChem CID | 68811608 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 2,4-bis[(dimethylamino)methyl]-5-hydroxy-1-methyl-6-pyridin-3-ylindole-3-carboxylic acid |
| SMILES | CN(C)Cc1c(O)c(-c2cccnc2)cc2c1c(C(=O)O)c(CN(C)C)n2C |
| InChI | InChI=1S/C21H26N4O3/c1-23(2)11-15-18-16(9-14(20(15)26)13-7-6-8-22-10-13)25(5)17(12-24(3)4)19(18)21(27)28/h6-10,26H,11-12H2,1-5H3,(H,27,28) |
| InChIKey | ZPGMUTLYBYBQHB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|