C25H30N4O3 — CID 88940141
[4-[(dimethylamino)methyl]-5-hydroxy-1-methyl-6-pyridin-3-yl-2-(pyrrolidin-1-ylmethyl)indol-3-yl]-(oxiran-2-yl)methanone (PubChem CID 88940141) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is [4-[(dimethylamino)methyl]-5-hydroxy-1-methyl-6-pyridin-3-yl-2-(pyrrolidin-1-ylmethyl)indol-3-yl]-(oxiran-2-yl)methanone.
| Compound Name | [4-[(dimethylamino)methyl]-5-hydroxy-1-methyl-6-pyridin-3-yl-2-(pyrrolidin-1-ylmethyl)indol-3-yl]-(oxiran-2-yl)methanone |
|---|---|
| PubChem CID | 88940141 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | [4-[(dimethylamino)methyl]-5-hydroxy-1-methyl-6-pyridin-3-yl-2-(pyrrolidin-1-ylmethyl)indol-3-yl]-(oxiran-2-yl)methanone |
| SMILES | CN(C)Cc1c(O)c(-c2cccnc2)cc2c1c(C(=O)C1CO1)c(CN1CCCC1)n2C |
| InChI | InChI=1S/C25H30N4O3/c1-27(2)13-18-22-19(11-17(24(18)30)16-7-6-8-26-12-16)28(3)20(14-29-9-4-5-10-29)23(22)25(31)21-15-32-21/h6-8,11-12,21,30H,4-5,9-10,13-15H2,1-3H3 |
| InChIKey | ILSIVFNLTNRSHP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|