C26H31Cl2N5O4 — CID 143583233
ethyl 5-hydroxy-1-methyl-2-(morpholin-4-ylmethyl)-4-(pyrazol-1-ylmethyl)-6-pyridin-3-ylindole-3-carboxylate;dihydrochloride (PubChem CID 143583233) has the molecular formula C26H31Cl2N5O4 and a molecular weight of 548.47 g/mol. Its IUPAC name is ethyl 5-hydroxy-1-methyl-2-(morpholin-4-ylmethyl)-4-(pyrazol-1-ylmethyl)-6-pyridin-3-ylindole-3-carboxylate;dihydrochloride.
| Compound Name | ethyl 5-hydroxy-1-methyl-2-(morpholin-4-ylmethyl)-4-(pyrazol-1-ylmethyl)-6-pyridin-3-ylindole-3-carboxylate;dihydrochloride |
|---|---|
| PubChem CID | 143583233 |
| Molecular Formula | C26H31Cl2N5O4 |
| Molecular Weight | 548.47 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | ethyl 5-hydroxy-1-methyl-2-(morpholin-4-ylmethyl)-4-(pyrazol-1-ylmethyl)-6-pyridin-3-ylindole-3-carboxylate;dihydrochloride |
| SMILES | CCOC(=O)c1c(CN2CCOCC2)n(C)c2cc(-c3cccnc3)c(O)c(Cn3cccn3)c12.Cl.Cl |
| InChI | InChI=1S/C26H29N5O4.2ClH/c1-3-35-26(33)24-22(17-30-10-12-34-13-11-30)29(2)21-14-19(18-6-4-7-27-15-18)25(32)20(23(21)24)16-31-9-5-8-28-31;;/h4-9,14-15,32H,3,10-13,16-17H2,1-2H3;2*1H |
| InChIKey | OUTLGKFJOUIUHP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|