C27H29N3O3 — CID 58327019
ethyl 2-(anilinomethyl)-5-hydroxy-1-methyl-4-(methylaminomethyl)-6-phenylindole-3-carboxylate (PubChem CID 58327019) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is ethyl 2-(anilinomethyl)-5-hydroxy-1-methyl-4-(methylaminomethyl)-6-phenylindole-3-carboxylate.
| Compound Name | ethyl 2-(anilinomethyl)-5-hydroxy-1-methyl-4-(methylaminomethyl)-6-phenylindole-3-carboxylate |
|---|---|
| PubChem CID | 58327019 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | ethyl 2-(anilinomethyl)-5-hydroxy-1-methyl-4-(methylaminomethyl)-6-phenylindole-3-carboxylate |
| SMILES | CCOC(=O)c1c(CNc2ccccc2)n(C)c2cc(-c3ccccc3)c(O)c(CNC)c12 |
| InChI | InChI=1S/C27H29N3O3/c1-4-33-27(32)25-23(17-29-19-13-9-6-10-14-19)30(3)22-15-20(18-11-7-5-8-12-18)26(31)21(16-28-2)24(22)25/h5-15,28-29,31H,4,16-17H2,1-3H3 |
| InChIKey | ZKKWWIJCWFKOSS-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|