C9H10F5N — CID 68813031
3-methylidene-4-(2,2,3,4,4-pentafluorobut-3-enyl)pyrrolidine (PubChem CID 68813031) has the molecular formula C9H10F5N and a molecular weight of 227.18 g/mol. Its IUPAC name is 3-methylidene-4-(2,2,3,4,4-pentafluorobut-3-enyl)pyrrolidine.
| Compound Name | 3-methylidene-4-(2,2,3,4,4-pentafluorobut-3-enyl)pyrrolidine |
|---|---|
| PubChem CID | 68813031 |
| Molecular Formula | C9H10F5N |
| Molecular Weight | 227.18 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 3-methylidene-4-(2,2,3,4,4-pentafluorobut-3-enyl)pyrrolidine |
| SMILES | C=C1CNCC1CC(F)(F)C(F)=C(F)F |
| InChI | InChI=1S/C9H10F5N/c1-5-3-15-4-6(5)2-9(13,14)7(10)8(11)12/h6,15H,1-4H2 |
| InChIKey | SDJQSONCZPPHQW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.18 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|