C8H14N2 — CID 165451425
5-prop-2-enyl-1,2,3,6-tetrahydropyridin-3-amine (PubChem CID 165451425) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is 5-prop-2-enyl-1,2,3,6-tetrahydropyridin-3-amine.
| Compound Name | 5-prop-2-enyl-1,2,3,6-tetrahydropyridin-3-amine |
|---|---|
| PubChem CID | 165451425 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 5-prop-2-enyl-1,2,3,6-tetrahydropyridin-3-amine |
| SMILES | C=CCC1=CC(N)CNC1 |
| InChI | InChI=1S/C8H14N2/c1-2-3-7-4-8(9)6-10-5-7/h2,4,8,10H,1,3,5-6,9H2 |
| InChIKey | HUUTXGVNARYNNQ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|