About 5-(1,2-thiazol-5-yl)-1,2,3,6-tetrahydropyridin-3-amine
5-(1,2-thiazol-5-yl)-1,2,3,6-tetrahydropyridin-3-amine (PubChem CID 165451525) has the molecular formula C8H11N3S
and a molecular weight of 181.26 g/mol. Its IUPAC name is 5-(1,2-thiazol-5-yl)-1,2,3,6-tetrahydropyridin-3-amine.
Analyze 5-(1,2-thiazol-5-yl)-1,2,3,6-tetrahydropyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,2-thiazol-5-yl)-1,2,3,6-tetrahydropyridin-3-amine?
The IUPAC name of 5-(1,2-thiazol-5-yl)-1,2,3,6-tetrahydropyridin-3-amine (CID 165451525) is 5-(1,2-thiazol-5-yl)-1,2,3,6-tetrahydropyridin-3-amine.
What is the SMILES notation for 5-(1,2-thiazol-5-yl)-1,2,3,6-tetrahydropyridin-3-amine?
The canonical SMILES for 5-(1,2-thiazol-5-yl)-1,2,3,6-tetrahydropyridin-3-amine is NC1C=C(c2ccns2)CNC1.
What is the InChIKey of 5-(1,2-thiazol-5-yl)-1,2,3,6-tetrahydropyridin-3-amine?
The InChIKey is GYXJPQUQTUIWSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3S/c9-7-3-6(4-10-5-7)8-1-2-11-12-8/h1-3,7,10H,4-5,9H2.
What are the key properties of 5-(1,2-thiazol-5-yl)-1,2,3,6-tetrahydropyridin-3-amine?
5-(1,2-thiazol-5-yl)-1,2,3,6-tetrahydropyridin-3-amine has a molecular weight of 181.26 g/mol, XLogP of 0.46, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,2-thiazol-5-yl)-1,2,3,6-tetrahydropyridin-3-amine is sourced from PubChem (CID 165451525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).