C8H12N2S — CID 131002484
2-(1,2-thiazol-5-yl)cyclopentan-1-amine (PubChem CID 131002484) has the molecular formula C8H12N2S and a molecular weight of 168.26 g/mol. Its IUPAC name is 2-(1,2-thiazol-5-yl)cyclopentan-1-amine.
| Compound Name | 2-(1,2-thiazol-5-yl)cyclopentan-1-amine |
|---|---|
| PubChem CID | 131002484 |
| Molecular Formula | C8H12N2S |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | 2-(1,2-thiazol-5-yl)cyclopentan-1-amine |
| SMILES | NC1CCCC1c1ccns1 |
| InChI | InChI=1S/C8H12N2S/c9-7-3-1-2-6(7)8-4-5-10-11-8/h4-7H,1-3,9H2 |
| InChIKey | AFQQLALQDNGAEQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |