C12H17N — CID 123606155
(5-prop-2-enyl-2-bicyclo[5.1.0]octa-2,4-dienyl)methanamine (PubChem CID 123606155) has the molecular formula C12H17N and a molecular weight of 175.27 g/mol. Its IUPAC name is (5-prop-2-enyl-2-bicyclo[5.1.0]octa-2,4-dienyl)methanamine.
| Compound Name | (5-prop-2-enyl-2-bicyclo[5.1.0]octa-2,4-dienyl)methanamine |
|---|---|
| PubChem CID | 123606155 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | (5-prop-2-enyl-2-bicyclo[5.1.0]octa-2,4-dienyl)methanamine |
| SMILES | C=CCC1=CC=C(CN)C2CC2C1 |
| InChI | InChI=1S/C12H17N/c1-2-3-9-4-5-10(8-13)12-7-11(12)6-9/h2,4-5,11-12H,1,3,6-8,13H2 |
| InChIKey | MQANUWSYEBREAB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|