C20H17ClN4O6 — CID 68813214
methyl 2-(5-acetamido-2-hydroxyphenyl)-4-[(4-chlorophenyl)methyl]-3,5-dioxo-1,2,4-triazine-6-carboxylate (PubChem CID 68813214) has the molecular formula C20H17ClN4O6 and a molecular weight of 444.83 g/mol. Its IUPAC name is methyl 2-(5-acetamido-2-hydroxyphenyl)-4-[(4-chlorophenyl)methyl]-3,5-dioxo-1,2,4-triazine-6-carboxylate.
| Compound Name | methyl 2-(5-acetamido-2-hydroxyphenyl)-4-[(4-chlorophenyl)methyl]-3,5-dioxo-1,2,4-triazine-6-carboxylate |
|---|---|
| PubChem CID | 68813214 |
| Molecular Formula | C20H17ClN4O6 |
| Molecular Weight | 444.83 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | methyl 2-(5-acetamido-2-hydroxyphenyl)-4-[(4-chlorophenyl)methyl]-3,5-dioxo-1,2,4-triazine-6-carboxylate |
| SMILES | COC(=O)c1nn(-c2cc(NC(C)=O)ccc2O)c(=O)n(Cc2ccc(Cl)cc2)c1=O |
| InChI | InChI=1S/C20H17ClN4O6/c1-11(26)22-14-7-8-16(27)15(9-14)25-20(30)24(10-12-3-5-13(21)6-4-12)18(28)17(23-25)19(29)31-2/h3-9,27H,10H2,1-2H3,(H,22,26) |
| InChIKey | SUHNYNFRUVNFII-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 132.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.83 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|