C42H42Br2N6O2S — CID 68815588
6-bromo-4-[4-[4-[[4-[4-(6-bromoquinolin-4-yl)-1,4-diazepan-1-yl]phenyl]methylsulfonylmethyl]phenyl]-1,4-diazepan-1-yl]quinoline (PubChem CID 68815588) has the molecular formula C42H42Br2N6O2S and a molecular weight of 854.71 g/mol. Its IUPAC name is 6-bromo-4-[4-[4-[[4-[4-(6-bromoquinolin-4-yl)-1,4-diazepan-1-yl]phenyl]methylsulfonylmethyl]phenyl]-1,4-diazepan-1-yl]quinoline.
| Compound Name | 6-bromo-4-[4-[4-[[4-[4-(6-bromoquinolin-4-yl)-1,4-diazepan-1-yl]phenyl]methylsulfonylmethyl]phenyl]-1,4-diazepan-1-yl]quinoline |
|---|---|
| PubChem CID | 68815588 |
| Molecular Formula | C42H42Br2N6O2S |
| Molecular Weight | 854.71 g/mol |
| Exact Mass | 852.15 |
| IUPAC Name | 6-bromo-4-[4-[4-[[4-[4-(6-bromoquinolin-4-yl)-1,4-diazepan-1-yl]phenyl]methylsulfonylmethyl]phenyl]-1,4-diazepan-1-yl]quinoline |
| SMILES | O=S(=O)(Cc1ccc(N2CCCN(c3ccnc4ccc(Br)cc34)CC2)cc1)Cc1ccc(N2CCCN(c3ccnc4ccc(Br)cc34)CC2)cc1 |
| InChI | InChI=1S/C42H42Br2N6O2S/c43-33-7-13-39-37(27-33)41(15-17-45-39)49-21-1-19-47(23-25-49)35-9-3-31(4-10-35)29-53(51,52)30-32-5-11-36(12-6-32)48-20-2-22-50(26-24-48)42-16-18-46-40-14-8-34(44)28-38(40)42/h3-18,27-28H,1-2,19-26,29-30H2 |
| InChIKey | YERYZUISHIWJTN-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 72.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.71 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|