C28H30FN5O3S — CID 68816324
4-[3-ethoxy-5-ethyl-2-fluoro-N-[[5-(2-methylsulfonylphenyl)-1H-imidazol-2-yl]methyl]anilino]benzenecarboximidamide (PubChem CID 68816324) has the molecular formula C28H30FN5O3S and a molecular weight of 535.65 g/mol. Its IUPAC name is 4-[3-ethoxy-5-ethyl-2-fluoro-N-[[5-(2-methylsulfonylphenyl)-1H-imidazol-2-yl]methyl]anilino]benzenecarboximidamide.
| Compound Name | 4-[3-ethoxy-5-ethyl-2-fluoro-N-[[5-(2-methylsulfonylphenyl)-1H-imidazol-2-yl]methyl]anilino]benzenecarboximidamide |
|---|---|
| PubChem CID | 68816324 |
| Molecular Formula | C28H30FN5O3S |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.21 |
| IUPAC Name | 4-[3-ethoxy-5-ethyl-2-fluoro-N-[[5-(2-methylsulfonylphenyl)-1H-imidazol-2-yl]methyl]anilino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N(Cc2ncc(-c3ccccc3S(C)(=O)=O)[nH]2)c2cc(CC)cc(OCC)c2F)cc1 |
| InChI | InChI=1S/C28H30FN5O3S/c1-4-18-14-23(27(29)24(15-18)37-5-2)34(20-12-10-19(11-13-20)28(30)31)17-26-32-16-22(33-26)21-8-6-7-9-25(21)38(3,35)36/h6-16H,4-5,17H2,1-3H3,(H3,30,31)(H,32,33) |
| InChIKey | CKLBIBHWWYAOLA-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 125.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|