C33H32F7N5O7 — CID 87586099
4-[5-ethoxy-2-fluoro-3-[(3S)-oxolan-3-yl]oxy-N-[(5-phenyl-1H-imidazol-2-yl)methyl]anilino]benzenecarboximidamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 87586099) has the molecular formula C33H32F7N5O7 and a molecular weight of 743.63 g/mol. Its IUPAC name is 4-[5-ethoxy-2-fluoro-3-[(3S)-oxolan-3-yl]oxy-N-[(5-phenyl-1H-imidazol-2-yl)methyl]anilino]benzenecarboximidamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-[5-ethoxy-2-fluoro-3-[(3S)-oxolan-3-yl]oxy-N-[(5-phenyl-1H-imidazol-2-yl)methyl]anilino]benzenecarboximidamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 87586099 |
| Molecular Formula | C33H32F7N5O7 |
| Molecular Weight | 743.63 g/mol |
| Exact Mass | 743.22 |
| IUPAC Name | 4-[5-ethoxy-2-fluoro-3-[(3S)-oxolan-3-yl]oxy-N-[(5-phenyl-1H-imidazol-2-yl)methyl]anilino]benzenecarboximidamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(N(Cc2ncc(-c3ccccc3)[nH]2)c2cc(OCC)cc(O[C@H]3CCOC3)c2F)cc1 |
| InChI | InChI=1S/C29H30FN5O3.2C2HF3O2/c1-2-37-23-14-25(28(30)26(15-23)38-22-12-13-36-18-22)35(21-10-8-20(9-11-21)29(31)32)17-27-33-16-24(34-27)19-6-4-3-5-7-19;2*3-2(4,5)1(6)7/h3-11,14-16,22H,2,12-13,17-18H2,1H3,(H3,31,32)(H,33,34);2*(H,6,7)/t22-;;/m0../s1 |
| InChIKey | ZVASFLTYAORVBL-IKXQUJFKSA-N |
| XLogP | 6.67 |
| TPSA | 184.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.63 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|