C32H55NO3 — CID 68817330
1-(dimethylamino)ethyl [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] carbonate (PubChem CID 68817330) has the molecular formula C32H55NO3 and a molecular weight of 501.80 g/mol. Its IUPAC name is 1-(dimethylamino)ethyl [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] carbonate.
| Compound Name | 1-(dimethylamino)ethyl [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] carbonate |
|---|---|
| PubChem CID | 68817330 |
| Molecular Formula | C32H55NO3 |
| Molecular Weight | 501.80 g/mol |
| Exact Mass | 501.42 |
| IUPAC Name | 1-(dimethylamino)ethyl [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] carbonate |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](OC(=O)OC(C)N(C)C)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C32H55NO3/c1-21(2)10-9-11-22(3)27-14-15-28-26-13-12-24-20-25(36-30(34)35-23(4)33(7)8)16-18-31(24,5)29(26)17-19-32(27,28)6/h12,21-23,25-29H,9-11,13-20H2,1-8H3/t22-,23?,25+,26+,27-,28+,29+,31+,32-/m1/s1 |
| InChIKey | PHTSPFNUDSUMJW-JERMORDKSA-N |
| XLogP | 8.46 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.80 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|