C10H17N3O4 — CID 68820431
(2S)-2,6-diaminohexanoic acid;pyrrole-2,5-dione (PubChem CID 68820431) has the molecular formula C10H17N3O4 and a molecular weight of 243.26 g/mol. Its IUPAC name is (2S)-2,6-diaminohexanoic acid;pyrrole-2,5-dione.
| Compound Name | (2S)-2,6-diaminohexanoic acid;pyrrole-2,5-dione |
|---|---|
| PubChem CID | 68820431 |
| Molecular Formula | C10H17N3O4 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | (2S)-2,6-diaminohexanoic acid;pyrrole-2,5-dione |
| SMILES | NCCCC[C@H](N)C(=O)O.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/C6H14N2O2.C4H3NO2/c7-4-2-1-3-5(8)6(9)10;6-3-1-2-4(7)5-3/h5H,1-4,7-8H2,(H,9,10);1-2H,(H,5,6,7)/t5-;/m0./s1 |
| InChIKey | LUIMYTKQMXOAPH-JEDNCBNOSA-N |
| XLogP | -1.27 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|