C10H15N3O4 — CID 90785740
(2S)-2,6-diamino-6-(2,5-dioxopyrrol-1-yl)hexanoic acid (PubChem CID 90785740) has the molecular formula C10H15N3O4 and a molecular weight of 241.25 g/mol. Its IUPAC name is (2S)-2,6-diamino-6-(2,5-dioxopyrrol-1-yl)hexanoic acid.
| Compound Name | (2S)-2,6-diamino-6-(2,5-dioxopyrrol-1-yl)hexanoic acid |
|---|---|
| PubChem CID | 90785740 |
| Molecular Formula | C10H15N3O4 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | (2S)-2,6-diamino-6-(2,5-dioxopyrrol-1-yl)hexanoic acid |
| SMILES | NC(CCC[C@H](N)C(=O)O)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C10H15N3O4/c11-6(10(16)17)2-1-3-7(12)13-8(14)4-5-9(13)15/h4-7H,1-3,11-12H2,(H,16,17)/t6-,7?/m0/s1 |
| InChIKey | GOGZVKPHOSZKMA-PKPIPKONSA-N |
| XLogP | -1.22 |
| TPSA | 126.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|