C18H30NO2Si — CID 68821160
CID 68821160 (PubChem CID 68821160) has the molecular formula C18H30NO2Si and a molecular weight of 320.53 g/mol.
| Compound Name | CID 68821160 |
|---|---|
| PubChem CID | 68821160 |
| Molecular Formula | C18H30NO2Si |
| Molecular Weight | 320.53 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | — |
| SMILES | COc1ccc2c(c1)CCN[C@@H]2CC(O[Si](C)C)C(C)(C)C |
| InChI | InChI=1S/C18H30NO2Si/c1-18(2,3)17(21-22(5)6)12-16-15-8-7-14(20-4)11-13(15)9-10-19-16/h7-8,11,16-17,19H,9-10,12H2,1-6H3/t16-,17?/m1/s1 |
| InChIKey | WMVSIVPEYABONN-TZHYSIJRSA-N |
| XLogP | 3.95 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.53 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|