C22H25Cl2N3O2 — CID 68821618
2-(2-amino-4-chlorophenoxy)-N-[8-[(4-chlorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]acetamide (PubChem CID 68821618) has the molecular formula C22H25Cl2N3O2 and a molecular weight of 434.37 g/mol. Its IUPAC name is 2-(2-amino-4-chlorophenoxy)-N-[8-[(4-chlorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]acetamide.
| Compound Name | 2-(2-amino-4-chlorophenoxy)-N-[8-[(4-chlorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]acetamide |
|---|---|
| PubChem CID | 68821618 |
| Molecular Formula | C22H25Cl2N3O2 |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 2-(2-amino-4-chlorophenoxy)-N-[8-[(4-chlorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]acetamide |
| SMILES | Nc1cc(Cl)ccc1OCC(=O)NC1CC2CCC(C1)N2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H25Cl2N3O2/c23-15-3-1-14(2-4-15)12-27-18-6-7-19(27)11-17(10-18)26-22(28)13-29-21-8-5-16(24)9-20(21)25/h1-5,8-9,17-19H,6-7,10-13,25H2,(H,26,28) |
| InChIKey | AASSQTBUSGGCMH-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|