C23H30N4OS — CID 68824394
[4-(6-cyclobutyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-yl)piperidin-1-yl]-(2-methyl-4-pyridinyl)methanone (PubChem CID 68824394) has the molecular formula C23H30N4OS and a molecular weight of 410.59 g/mol. Its IUPAC name is [4-(6-cyclobutyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-yl)piperidin-1-yl]-(2-methyl-4-pyridinyl)methanone.
| Compound Name | [4-(6-cyclobutyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-yl)piperidin-1-yl]-(2-methyl-4-pyridinyl)methanone |
|---|---|
| PubChem CID | 68824394 |
| Molecular Formula | C23H30N4OS |
| Molecular Weight | 410.59 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | [4-(6-cyclobutyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-yl)piperidin-1-yl]-(2-methyl-4-pyridinyl)methanone |
| SMILES | Cc1cc(C(=O)N2CCC(c3nc4c(s3)CCN(C3CCC3)CC4)CC2)ccn1 |
| InChI | InChI=1S/C23H30N4OS/c1-16-15-18(5-10-24-16)23(28)27-11-6-17(7-12-27)22-25-20-8-13-26(19-3-2-4-19)14-9-21(20)29-22/h5,10,15,17,19H,2-4,6-9,11-14H2,1H3 |
| InChIKey | RKKSFIDZQDMJLF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.59 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |