C27H35N5O — CID 68825389
1-[2-(4-tert-butyl-2-methylphenyl)pyrazol-3-yl]-3-[4-(piperidin-4-ylmethyl)phenyl]urea (PubChem CID 68825389) has the molecular formula C27H35N5O and a molecular weight of 445.61 g/mol. Its IUPAC name is 1-[2-(4-tert-butyl-2-methylphenyl)pyrazol-3-yl]-3-[4-(piperidin-4-ylmethyl)phenyl]urea.
| Compound Name | 1-[2-(4-tert-butyl-2-methylphenyl)pyrazol-3-yl]-3-[4-(piperidin-4-ylmethyl)phenyl]urea |
|---|---|
| PubChem CID | 68825389 |
| Molecular Formula | C27H35N5O |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.28 |
| IUPAC Name | 1-[2-(4-tert-butyl-2-methylphenyl)pyrazol-3-yl]-3-[4-(piperidin-4-ylmethyl)phenyl]urea |
| SMILES | Cc1cc(C(C)(C)C)ccc1-n1nccc1NC(=O)Nc1ccc(CC2CCNCC2)cc1 |
| InChI | InChI=1S/C27H35N5O/c1-19-17-22(27(2,3)4)7-10-24(19)32-25(13-16-29-32)31-26(33)30-23-8-5-20(6-9-23)18-21-11-14-28-15-12-21/h5-10,13,16-17,21,28H,11-12,14-15,18H2,1-4H3,(H2,30,31,33) |
| InChIKey | JNUYKCNKEHUKOD-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |