C20H30N6O — CID 59420865
1-(3-tert-butyl-1-methylpyrazol-5-yl)-3-[4-(piperazin-1-ylmethyl)phenyl]urea (PubChem CID 59420865) has the molecular formula C20H30N6O and a molecular weight of 370.50 g/mol. Its IUPAC name is 1-(3-tert-butyl-1-methylpyrazol-5-yl)-3-[4-(piperazin-1-ylmethyl)phenyl]urea.
| Compound Name | 1-(3-tert-butyl-1-methylpyrazol-5-yl)-3-[4-(piperazin-1-ylmethyl)phenyl]urea |
|---|---|
| PubChem CID | 59420865 |
| Molecular Formula | C20H30N6O |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | 1-(3-tert-butyl-1-methylpyrazol-5-yl)-3-[4-(piperazin-1-ylmethyl)phenyl]urea |
| SMILES | Cn1nc(C(C)(C)C)cc1NC(=O)Nc1ccc(CN2CCNCC2)cc1 |
| InChI | InChI=1S/C20H30N6O/c1-20(2,3)17-13-18(25(4)24-17)23-19(27)22-16-7-5-15(6-8-16)14-26-11-9-21-10-12-26/h5-8,13,21H,9-12,14H2,1-4H3,(H2,22,23,27) |
| InChIKey | NWCQKTYVWBWUPQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |