C25H22N2O3S — CID 68825631
2-[[3-[(4-methylphenyl)carbamoyl]phenyl]methyl-sulfinoamino]naphthalene (PubChem CID 68825631) has the molecular formula C25H22N2O3S and a molecular weight of 430.53 g/mol. Its IUPAC name is 2-[[3-[(4-methylphenyl)carbamoyl]phenyl]methyl-sulfinoamino]naphthalene.
| Compound Name | 2-[[3-[(4-methylphenyl)carbamoyl]phenyl]methyl-sulfinoamino]naphthalene |
|---|---|
| PubChem CID | 68825631 |
| Molecular Formula | C25H22N2O3S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 2-[[3-[(4-methylphenyl)carbamoyl]phenyl]methyl-sulfinoamino]naphthalene |
| SMILES | Cc1ccc(NC(=O)c2cccc(CN(c3ccc4ccccc4c3)S(=O)O)c2)cc1 |
| InChI | InChI=1S/C25H22N2O3S/c1-18-9-12-23(13-10-18)26-25(28)22-8-4-5-19(15-22)17-27(31(29)30)24-14-11-20-6-2-3-7-21(20)16-24/h2-16H,17H2,1H3,(H,26,28)(H,29,30) |
| InChIKey | ZXMNLKVEBHZUKJ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|