C28H31NO6S — CID 68825781
1-(1,4-dioxaspiro[4.5]decan-8-ylidene)-3-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylpropan-2-ol (PubChem CID 68825781) has the molecular formula C28H31NO6S and a molecular weight of 509.62 g/mol. Its IUPAC name is 1-(1,4-dioxaspiro[4.5]decan-8-ylidene)-3-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylpropan-2-ol.
| Compound Name | 1-(1,4-dioxaspiro[4.5]decan-8-ylidene)-3-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylpropan-2-ol |
|---|---|
| PubChem CID | 68825781 |
| Molecular Formula | C28H31NO6S |
| Molecular Weight | 509.62 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | 1-(1,4-dioxaspiro[4.5]decan-8-ylidene)-3-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylpropan-2-ol |
| SMILES | Cc1cc(COc2ccc(S(=O)(=O)CC(O)C=C3CCC4(CC3)OCCO4)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C28H31NO6S/c1-20-16-22(26-4-2-3-5-27(26)29-20)18-33-24-6-8-25(9-7-24)36(31,32)19-23(30)17-21-10-12-28(13-11-21)34-14-15-35-28/h2-9,16-17,23,30H,10-15,18-19H2,1H3 |
| InChIKey | PDFZWXGWJQRZDF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 94.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.62 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|