C26H28N4O3S2 — CID 22032802
5-[1-cyclopentyl-2-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylethyl]-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 22032802) has the molecular formula C26H28N4O3S2 and a molecular weight of 508.67 g/mol. Its IUPAC name is 5-[1-cyclopentyl-2-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylethyl]-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-[1-cyclopentyl-2-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylethyl]-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 22032802 |
| Molecular Formula | C26H28N4O3S2 |
| Molecular Weight | 508.67 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | 5-[1-cyclopentyl-2-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylethyl]-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | Cc1cc(COc2ccc(S(=O)(=O)CC(c3nc(=S)[nH][nH]3)C3CCCC3)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C26H28N4O3S2/c1-17-14-19(22-8-4-5-9-24(22)27-17)15-33-20-10-12-21(13-11-20)35(31,32)16-23(18-6-2-3-7-18)25-28-26(34)30-29-25/h4-5,8-14,18,23H,2-3,6-7,15-16H2,1H3,(H2,28,29,30,34) |
| InChIKey | BUUGILHROVIBDA-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 100.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.67 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|