C23H16Cl2FN4O3S2- — CID 68831130
3-benzyl-4-[5-chloro-2-[(4-chloro-2-fluorophenyl)methylcarbamoyl]-N-sulfinatoanilino]-1,2,5-thiadiazole (PubChem CID 68831130) has the molecular formula C23H16Cl2FN4O3S2- and a molecular weight of 550.44 g/mol. Its IUPAC name is 3-benzyl-4-[5-chloro-2-[(4-chloro-2-fluorophenyl)methylcarbamoyl]-N-sulfinatoanilino]-1,2,5-thiadiazole.
| Compound Name | 3-benzyl-4-[5-chloro-2-[(4-chloro-2-fluorophenyl)methylcarbamoyl]-N-sulfinatoanilino]-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 68831130 |
| Molecular Formula | C23H16Cl2FN4O3S2- |
| Molecular Weight | 550.44 g/mol |
| Exact Mass | 549.00 |
| IUPAC Name | 3-benzyl-4-[5-chloro-2-[(4-chloro-2-fluorophenyl)methylcarbamoyl]-N-sulfinatoanilino]-1,2,5-thiadiazole |
| SMILES | O=C(NCc1ccc(Cl)cc1F)c1ccc(Cl)cc1N(c1nsnc1Cc1ccccc1)S(=O)[O-] |
| InChI | InChI=1S/C23H17Cl2FN4O3S2/c24-16-7-6-15(19(26)11-16)13-27-23(31)18-9-8-17(25)12-21(18)30(35(32)33)22-20(28-34-29-22)10-14-4-2-1-3-5-14/h1-9,11-12H,10,13H2,(H,27,31)(H,32,33)/p-1 |
| InChIKey | CUTFDDDDAKYNGN-UHFFFAOYSA-M |
| XLogP | 5.44 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.44 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|