C24H20ClN4O4S2- — CID 68833391
3-benzyl-4-[5-chloro-2-[(2-hydroxy-1-phenylethyl)carbamoyl]-N-sulfinatoanilino]-1,2,5-thiadiazole (PubChem CID 68833391) has the molecular formula C24H20ClN4O4S2- and a molecular weight of 528.04 g/mol. Its IUPAC name is 3-benzyl-4-[5-chloro-2-[(2-hydroxy-1-phenylethyl)carbamoyl]-N-sulfinatoanilino]-1,2,5-thiadiazole.
| Compound Name | 3-benzyl-4-[5-chloro-2-[(2-hydroxy-1-phenylethyl)carbamoyl]-N-sulfinatoanilino]-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 68833391 |
| Molecular Formula | C24H20ClN4O4S2- |
| Molecular Weight | 528.04 g/mol |
| Exact Mass | 527.06 |
| IUPAC Name | 3-benzyl-4-[5-chloro-2-[(2-hydroxy-1-phenylethyl)carbamoyl]-N-sulfinatoanilino]-1,2,5-thiadiazole |
| SMILES | O=C(NC(CO)c1ccccc1)c1ccc(Cl)cc1N(c1nsnc1Cc1ccccc1)S(=O)[O-] |
| InChI | InChI=1S/C24H21ClN4O4S2/c25-18-11-12-19(24(31)26-21(15-30)17-9-5-2-6-10-17)22(14-18)29(35(32)33)23-20(27-34-28-23)13-16-7-3-1-4-8-16/h1-12,14,21,30H,13,15H2,(H,26,31)(H,32,33)/p-1 |
| InChIKey | YUUNGVOHLFVAFZ-UHFFFAOYSA-M |
| XLogP | 4.18 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.04 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|