C22H14Cl3N4O3S2- — CID 91214921
3-benzyl-4-[4-chloro-2-[(3,4-dichlorophenyl)carbamoyl]-N-sulfinatoanilino]-1,2,5-thiadiazole (PubChem CID 91214921) has the molecular formula C22H14Cl3N4O3S2- and a molecular weight of 552.87 g/mol. Its IUPAC name is 3-benzyl-4-[4-chloro-2-[(3,4-dichlorophenyl)carbamoyl]-N-sulfinatoanilino]-1,2,5-thiadiazole.
| Compound Name | 3-benzyl-4-[4-chloro-2-[(3,4-dichlorophenyl)carbamoyl]-N-sulfinatoanilino]-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 91214921 |
| Molecular Formula | C22H14Cl3N4O3S2- |
| Molecular Weight | 552.87 g/mol |
| Exact Mass | 550.96 |
| IUPAC Name | 3-benzyl-4-[4-chloro-2-[(3,4-dichlorophenyl)carbamoyl]-N-sulfinatoanilino]-1,2,5-thiadiazole |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)c1cc(Cl)ccc1N(c1nsnc1Cc1ccccc1)S(=O)[O-] |
| InChI | InChI=1S/C22H15Cl3N4O3S2/c23-14-6-9-20(16(11-14)22(30)26-15-7-8-17(24)18(25)12-15)29(34(31)32)21-19(27-33-28-21)10-13-4-2-1-3-5-13/h1-9,11-12H,10H2,(H,26,30)(H,31,32)/p-1 |
| InChIKey | POAGYDOUTAYTHT-UHFFFAOYSA-M |
| XLogP | 6.27 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.87 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|