C21H17N3O4S2 — CID 68831854
3-benzyl-4-[(3-methoxycarbonylnaphthalen-2-yl)-sulfinoamino]-1,2,5-thiadiazole (PubChem CID 68831854) has the molecular formula C21H17N3O4S2 and a molecular weight of 439.52 g/mol. Its IUPAC name is 3-benzyl-4-[(3-methoxycarbonylnaphthalen-2-yl)-sulfinoamino]-1,2,5-thiadiazole.
| Compound Name | 3-benzyl-4-[(3-methoxycarbonylnaphthalen-2-yl)-sulfinoamino]-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 68831854 |
| Molecular Formula | C21H17N3O4S2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | 3-benzyl-4-[(3-methoxycarbonylnaphthalen-2-yl)-sulfinoamino]-1,2,5-thiadiazole |
| SMILES | COC(=O)c1cc2ccccc2cc1N(c1nsnc1Cc1ccccc1)S(=O)O |
| InChI | InChI=1S/C21H17N3O4S2/c1-28-21(25)17-12-15-9-5-6-10-16(15)13-19(17)24(30(26)27)20-18(22-29-23-20)11-14-7-3-2-4-8-14/h2-10,12-13H,11H2,1H3,(H,26,27) |
| InChIKey | XHIPZTKRWOQAPN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|