C16H11ClN3O4S2- — CID 68770228
3-benzyl-4-(2-carboxy-4-chloro-N-sulfinatoanilino)-1,2,5-thiadiazole (PubChem CID 68770228) has the molecular formula C16H11ClN3O4S2- and a molecular weight of 408.87 g/mol. Its IUPAC name is 3-benzyl-4-(2-carboxy-4-chloro-N-sulfinatoanilino)-1,2,5-thiadiazole.
| Compound Name | 3-benzyl-4-(2-carboxy-4-chloro-N-sulfinatoanilino)-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 68770228 |
| Molecular Formula | C16H11ClN3O4S2- |
| Molecular Weight | 408.87 g/mol |
| Exact Mass | 407.99 |
| IUPAC Name | 3-benzyl-4-(2-carboxy-4-chloro-N-sulfinatoanilino)-1,2,5-thiadiazole |
| SMILES | O=C(O)c1cc(Cl)ccc1N(c1nsnc1Cc1ccccc1)S(=O)[O-] |
| InChI | InChI=1S/C16H12ClN3O4S2/c17-11-6-7-14(12(9-11)16(21)22)20(26(23)24)15-13(18-25-19-15)8-10-4-2-1-3-5-10/h1-7,9H,8H2,(H,21,22)(H,23,24)/p-1 |
| InChIKey | PCWLJMJKCAQKTE-UHFFFAOYSA-M |
| XLogP | 3.41 |
| TPSA | 106.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.87 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|