C11H18O4 — CID 68831523
(E)-3-[1,4-bis(hydroxymethyl)cyclohexyl]prop-2-enoic acid (PubChem CID 68831523) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is (E)-3-[1,4-bis(hydroxymethyl)cyclohexyl]prop-2-enoic acid.
| Compound Name | (E)-3-[1,4-bis(hydroxymethyl)cyclohexyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68831523 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | (E)-3-[1,4-bis(hydroxymethyl)cyclohexyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/C1(CO)CCC(CO)CC1 |
| InChI | InChI=1S/C11H18O4/c12-7-9-1-4-11(8-13,5-2-9)6-3-10(14)15/h3,6,9,12-13H,1-2,4-5,7-8H2,(H,14,15)/b6-3+ |
| InChIKey | ZLRNLLTXNARUKU-ZZXKWVIFSA-N |
| XLogP | 0.79 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|