C27H28N4O6 — CID 68832101
methyl 4-amino-2-[[4-cyano-2-[2-[[4-(pyrrolidine-1-carbonyl)benzoyl]amino]ethoxy]phenyl]methylidene]-4-oxobutanoate (PubChem CID 68832101) has the molecular formula C27H28N4O6 and a molecular weight of 504.54 g/mol. Its IUPAC name is methyl 4-amino-2-[[4-cyano-2-[2-[[4-(pyrrolidine-1-carbonyl)benzoyl]amino]ethoxy]phenyl]methylidene]-4-oxobutanoate.
| Compound Name | methyl 4-amino-2-[[4-cyano-2-[2-[[4-(pyrrolidine-1-carbonyl)benzoyl]amino]ethoxy]phenyl]methylidene]-4-oxobutanoate |
|---|---|
| PubChem CID | 68832101 |
| Molecular Formula | C27H28N4O6 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | methyl 4-amino-2-[[4-cyano-2-[2-[[4-(pyrrolidine-1-carbonyl)benzoyl]amino]ethoxy]phenyl]methylidene]-4-oxobutanoate |
| SMILES | COC(=O)C(=Cc1ccc(C#N)cc1OCCNC(=O)c1ccc(C(=O)N2CCCC2)cc1)CC(N)=O |
| InChI | InChI=1S/C27H28N4O6/c1-36-27(35)22(16-24(29)32)15-21-5-4-18(17-28)14-23(21)37-13-10-30-25(33)19-6-8-20(9-7-19)26(34)31-11-2-3-12-31/h4-9,14-15H,2-3,10-13,16H2,1H3,(H2,29,32)(H,30,33) |
| InChIKey | ATFDPGOEDYJXIC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 151.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|