C15H12ClFN2O4 — CID 68832248
2-[(3-chlorophenyl)-fluoromethyl]-8,9-dihydroxy-3,4-dihydropyrido[1,2-a]pyrazine-1,6-dione (PubChem CID 68832248) has the molecular formula C15H12ClFN2O4 and a molecular weight of 338.72 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)-fluoromethyl]-8,9-dihydroxy-3,4-dihydropyrido[1,2-a]pyrazine-1,6-dione.
| Compound Name | 2-[(3-chlorophenyl)-fluoromethyl]-8,9-dihydroxy-3,4-dihydropyrido[1,2-a]pyrazine-1,6-dione |
|---|---|
| PubChem CID | 68832248 |
| Molecular Formula | C15H12ClFN2O4 |
| Molecular Weight | 338.72 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 2-[(3-chlorophenyl)-fluoromethyl]-8,9-dihydroxy-3,4-dihydropyrido[1,2-a]pyrazine-1,6-dione |
| SMILES | O=C1c2c(O)c(O)cc(=O)n2CCN1C(F)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H12ClFN2O4/c16-9-3-1-2-8(6-9)14(17)19-5-4-18-11(21)7-10(20)13(22)12(18)15(19)23/h1-3,6-7,14,20,22H,4-5H2 |
| InChIKey | VSIFWTVZEZIDDV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 82.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.72 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|