C11H26O2Si2 — CID 68832870
1-(2,2,3,3-tetramethyloxadisilinan-6-yl)butan-1-ol (PubChem CID 68832870) has the molecular formula C11H26O2Si2 and a molecular weight of 246.50 g/mol. Its IUPAC name is 1-(2,2,3,3-tetramethyloxadisilinan-6-yl)butan-1-ol.
| Compound Name | 1-(2,2,3,3-tetramethyloxadisilinan-6-yl)butan-1-ol |
|---|---|
| PubChem CID | 68832870 |
| Molecular Formula | C11H26O2Si2 |
| Molecular Weight | 246.50 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 1-(2,2,3,3-tetramethyloxadisilinan-6-yl)butan-1-ol |
| SMILES | CCCC(O)C1CC[Si](C)(C)[Si](C)(C)O1 |
| InChI | InChI=1S/C11H26O2Si2/c1-6-7-10(12)11-8-9-14(2,3)15(4,5)13-11/h10-12H,6-9H2,1-5H3 |
| InChIKey | DVIDBEJKWLUCCO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.50 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|