C18H17NO4 — CID 68833578
3-[4-(3-acetylphenyl)phenyl]-4-amino-4-oxobutanoic acid (PubChem CID 68833578) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is 3-[4-(3-acetylphenyl)phenyl]-4-amino-4-oxobutanoic acid.
| Compound Name | 3-[4-(3-acetylphenyl)phenyl]-4-amino-4-oxobutanoic acid |
|---|---|
| PubChem CID | 68833578 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 3-[4-(3-acetylphenyl)phenyl]-4-amino-4-oxobutanoic acid |
| SMILES | CC(=O)c1cccc(-c2ccc(C(CC(=O)O)C(N)=O)cc2)c1 |
| InChI | InChI=1S/C18H17NO4/c1-11(20)14-3-2-4-15(9-14)12-5-7-13(8-6-12)16(18(19)23)10-17(21)22/h2-9,16H,10H2,1H3,(H2,19,23)(H,21,22) |
| InChIKey | SBGOKJYOHJSEAP-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |