C22H26ClNO4 — CID 68834407
ethyl 2-[[7-[[(1S)-2-(3-chlorophenyl)-1-hydroxyethyl]amino]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]acetate (PubChem CID 68834407) has the molecular formula C22H26ClNO4 and a molecular weight of 403.91 g/mol. Its IUPAC name is ethyl 2-[[7-[[(1S)-2-(3-chlorophenyl)-1-hydroxyethyl]amino]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]acetate.
| Compound Name | ethyl 2-[[7-[[(1S)-2-(3-chlorophenyl)-1-hydroxyethyl]amino]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]acetate |
|---|---|
| PubChem CID | 68834407 |
| Molecular Formula | C22H26ClNO4 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | ethyl 2-[[7-[[(1S)-2-(3-chlorophenyl)-1-hydroxyethyl]amino]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]acetate |
| SMILES | CCOC(=O)COc1ccc2c(c1)CC(N[C@@H](O)Cc1cccc(Cl)c1)CC2 |
| InChI | InChI=1S/C22H26ClNO4/c1-2-27-22(26)14-28-20-9-7-16-6-8-19(12-17(16)13-20)24-21(25)11-15-4-3-5-18(23)10-15/h3-5,7,9-10,13,19,21,24-25H,2,6,8,11-12,14H2,1H3/t19?,21-/m0/s1 |
| InChIKey | GPWGAVKPVNWKPN-QWAKEFERSA-N |
| XLogP | 3.29 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|