C26H24ClN3O9S — CID 68835643
3-(carboxymethoxy)-4-chloro-5-[3-[2-(N-nitroanilino)-2-oxo-1-piperidin-4-ylethoxy]phenyl]thiophene-2-carboxylic acid (PubChem CID 68835643) has the molecular formula C26H24ClN3O9S and a molecular weight of 590.01 g/mol. Its IUPAC name is 3-(carboxymethoxy)-4-chloro-5-[3-[2-(N-nitroanilino)-2-oxo-1-piperidin-4-ylethoxy]phenyl]thiophene-2-carboxylic acid.
| Compound Name | 3-(carboxymethoxy)-4-chloro-5-[3-[2-(N-nitroanilino)-2-oxo-1-piperidin-4-ylethoxy]phenyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 68835643 |
| Molecular Formula | C26H24ClN3O9S |
| Molecular Weight | 590.01 g/mol |
| Exact Mass | 589.09 |
| IUPAC Name | 3-(carboxymethoxy)-4-chloro-5-[3-[2-(N-nitroanilino)-2-oxo-1-piperidin-4-ylethoxy]phenyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)COc1c(C(=O)O)sc(-c2cccc(OC(C(=O)N(c3ccccc3)[N+](=O)[O-])C3CCNCC3)c2)c1Cl |
| InChI | InChI=1S/C26H24ClN3O9S/c27-20-22(38-14-19(31)32)24(26(34)35)40-23(20)16-5-4-8-18(13-16)39-21(15-9-11-28-12-10-15)25(33)29(30(36)37)17-6-2-1-3-7-17/h1-8,13,15,21,28H,9-12,14H2,(H,31,32)(H,34,35) |
| InChIKey | ONGUCINJFJRNAG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 168.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.01 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|