C20H43N11 — CID 68836529
1,1,2,3-tetra(piperazin-1-yl)-3-propylguanidine (PubChem CID 68836529) has the molecular formula C20H43N11 and a molecular weight of 437.64 g/mol. Its IUPAC name is 1,1,2,3-tetra(piperazin-1-yl)-3-propylguanidine.
| Compound Name | 1,1,2,3-tetra(piperazin-1-yl)-3-propylguanidine |
|---|---|
| PubChem CID | 68836529 |
| Molecular Formula | C20H43N11 |
| Molecular Weight | 437.64 g/mol |
| Exact Mass | 437.37 |
| IUPAC Name | 1,1,2,3-tetra(piperazin-1-yl)-3-propylguanidine |
| SMILES | CCCN(C(=NN1CCNCC1)N(N1CCNCC1)N1CCNCC1)N1CCNCC1 |
| InChI | InChI=1S/C20H43N11/c1-2-11-30(27-14-5-22-6-15-27)20(25-26-12-3-21-4-13-26)31(28-16-7-23-8-17-28)29-18-9-24-10-19-29/h21-24H,2-19H2,1H3 |
| InChIKey | SOLDMBALACSHOT-UHFFFAOYSA-N |
| XLogP | -2.36 |
| TPSA | 79.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.64 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|