methyl 2-(4,5-dibromo-2-carbamoylthiophen-3-yl)oxyacetate

C8H7Br2NO4S — CID 68837083

IUPACmethyl 2-(4,5-dibromo-2-carbamoylthiophen-3-yl)oxyacetate
SMILESCOC(=O)COc1c(C(N)=O)sc(Br)c1Br
InChIInChI=1S/C8H7Br2NO4S/c1-14-3(12)2-15-5-4(9)7(10)16-6(5)8(11)13/h2H2,1H3,(H2,11,13)
InChIKeyQJEJHNQAFJGYOI-UHFFFAOYSA-N
MW373.02 g/mol
LogP1.92
Rot. Bonds4

About methyl 2-(4,5-dibromo-2-carbamoylthiophen-3-yl)oxyacetate

methyl 2-(4,5-dibromo-2-carbamoylthiophen-3-yl)oxyacetate (PubChem CID 68837083) has the molecular formula C8H7Br2NO4S and a molecular weight of 373.02 g/mol. Its IUPAC name is methyl 2-(4,5-dibromo-2-carbamoylthiophen-3-yl)oxyacetate.

Molecular Properties

Compound Namemethyl 2-(4,5-dibromo-2-carbamoylthiophen-3-yl)oxyacetate
PubChem CID68837083
Molecular FormulaC8H7Br2NO4S
Molecular Weight373.02 g/mol
Exact Mass370.85
IUPAC Namemethyl 2-(4,5-dibromo-2-carbamoylthiophen-3-yl)oxyacetate
SMILESCOC(=O)COc1c(C(N)=O)sc(Br)c1Br
InChIInChI=1S/C8H7Br2NO4S/c1-14-3(12)2-15-5-4(9)7(10)16-6(5)8(11)13/h2H2,1H3,(H2,11,13)
InChIKeyQJEJHNQAFJGYOI-UHFFFAOYSA-N
XLogP1.92
TPSA78.62 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500373.02
LogP ≤ 51.92
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 2-(4,5-dibromo-2-carbamoylthiophen-3-yl)oxyacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(4,5-dibromo-2-carbamoylthiophen-3-yl)oxyacetate?
The IUPAC name of methyl 2-(4,5-dibromo-2-carbamoylthiophen-3-yl)oxyacetate (CID 68837083) is methyl 2-(4,5-dibromo-2-carbamoylthiophen-3-yl)oxyacetate.
What is the SMILES notation for methyl 2-(4,5-dibromo-2-carbamoylthiophen-3-yl)oxyacetate?
The canonical SMILES for methyl 2-(4,5-dibromo-2-carbamoylthiophen-3-yl)oxyacetate is COC(=O)COc1c(C(N)=O)sc(Br)c1Br.
What is the InChIKey of methyl 2-(4,5-dibromo-2-carbamoylthiophen-3-yl)oxyacetate?
The InChIKey is QJEJHNQAFJGYOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7Br2NO4S/c1-14-3(12)2-15-5-4(9)7(10)16-6(5)8(11)13/h2H2,1H3,(H2,11,13).
What are the key properties of methyl 2-(4,5-dibromo-2-carbamoylthiophen-3-yl)oxyacetate?
methyl 2-(4,5-dibromo-2-carbamoylthiophen-3-yl)oxyacetate has a molecular weight of 373.02 g/mol, XLogP of 1.92, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4,5-dibromo-2-carbamoylthiophen-3-yl)oxyacetate is sourced from PubChem (CID 68837083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).