C8H7Br2NO4S — CID 68837083
methyl 2-(4,5-dibromo-2-carbamoylthiophen-3-yl)oxyacetate (PubChem CID 68837083) has the molecular formula C8H7Br2NO4S and a molecular weight of 373.02 g/mol. Its IUPAC name is methyl 2-(4,5-dibromo-2-carbamoylthiophen-3-yl)oxyacetate.
| Compound Name | methyl 2-(4,5-dibromo-2-carbamoylthiophen-3-yl)oxyacetate |
|---|---|
| PubChem CID | 68837083 |
| Molecular Formula | C8H7Br2NO4S |
| Molecular Weight | 373.02 g/mol |
| Exact Mass | 370.85 |
| IUPAC Name | methyl 2-(4,5-dibromo-2-carbamoylthiophen-3-yl)oxyacetate |
| SMILES | COC(=O)COc1c(C(N)=O)sc(Br)c1Br |
| InChI | InChI=1S/C8H7Br2NO4S/c1-14-3(12)2-15-5-4(9)7(10)16-6(5)8(11)13/h2H2,1H3,(H2,11,13) |
| InChIKey | QJEJHNQAFJGYOI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.02 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |