C39H40N4O10S — CID 68837878
methyl 2-[4-[[2-acetamido-3-[3-phenylmethoxy-4-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)phenyl]prop-2-enoyl]amino]butoxy]-6-phenylmethoxybenzoate (PubChem CID 68837878) has the molecular formula C39H40N4O10S and a molecular weight of 756.83 g/mol. Its IUPAC name is methyl 2-[4-[[2-acetamido-3-[3-phenylmethoxy-4-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)phenyl]prop-2-enoyl]amino]butoxy]-6-phenylmethoxybenzoate.
| Compound Name | methyl 2-[4-[[2-acetamido-3-[3-phenylmethoxy-4-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)phenyl]prop-2-enoyl]amino]butoxy]-6-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 68837878 |
| Molecular Formula | C39H40N4O10S |
| Molecular Weight | 756.83 g/mol |
| Exact Mass | 756.25 |
| IUPAC Name | methyl 2-[4-[[2-acetamido-3-[3-phenylmethoxy-4-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)phenyl]prop-2-enoyl]amino]butoxy]-6-phenylmethoxybenzoate |
| SMILES | COC(=O)c1c(OCCCCNC(=O)C(=Cc2ccc(N3CC(=O)NS3(=O)=O)c(OCc3ccccc3)c2)NC(C)=O)cccc1OCc1ccccc1 |
| InChI | InChI=1S/C39H40N4O10S/c1-27(44)41-31(22-30-18-19-32(43-24-36(45)42-54(43,48)49)35(23-30)53-26-29-14-7-4-8-15-29)38(46)40-20-9-10-21-51-33-16-11-17-34(37(33)39(47)50-2)52-25-28-12-5-3-6-13-28/h3-8,11-19,22-23H,9-10,20-21,24-26H2,1-2H3,(H,40,46)(H,41,44)(H,42,45) |
| InChIKey | JQZSPUCOFPHZLP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 178.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.83 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|