C11H11ClN2O — CID 68839140
4-[2-(4-chlorophenyl)ethyl]-1,3-dihydroimidazol-2-one (PubChem CID 68839140) has the molecular formula C11H11ClN2O and a molecular weight of 222.68 g/mol. Its IUPAC name is 4-[2-(4-chlorophenyl)ethyl]-1,3-dihydroimidazol-2-one.
| Compound Name | 4-[2-(4-chlorophenyl)ethyl]-1,3-dihydroimidazol-2-one |
|---|---|
| PubChem CID | 68839140 |
| Molecular Formula | C11H11ClN2O |
| Molecular Weight | 222.68 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 4-[2-(4-chlorophenyl)ethyl]-1,3-dihydroimidazol-2-one |
| SMILES | O=c1[nH]cc(CCc2ccc(Cl)cc2)[nH]1 |
| InChI | InChI=1S/C11H11ClN2O/c12-9-4-1-8(2-5-9)3-6-10-7-13-11(15)14-10/h1-2,4-5,7H,3,6H2,(H2,13,14,15) |
| InChIKey | RRRDGMKJISWKHX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.68 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |