C13H12ClNO — CID 58252401
6-[(4-chlorophenyl)methyl]-3-methyl-1H-pyridin-2-one (PubChem CID 58252401) has the molecular formula C13H12ClNO and a molecular weight of 233.70 g/mol. Its IUPAC name is 6-[(4-chlorophenyl)methyl]-3-methyl-1H-pyridin-2-one.
| Compound Name | 6-[(4-chlorophenyl)methyl]-3-methyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 58252401 |
| Molecular Formula | C13H12ClNO |
| Molecular Weight | 233.70 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 6-[(4-chlorophenyl)methyl]-3-methyl-1H-pyridin-2-one |
| SMILES | Cc1ccc(Cc2ccc(Cl)cc2)[nH]c1=O |
| InChI | InChI=1S/C13H12ClNO/c1-9-2-7-12(15-13(9)16)8-10-3-5-11(14)6-4-10/h2-7H,8H2,1H3,(H,15,16) |
| InChIKey | HMVSCNLAUMHOOC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.70 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |