C25H30N2O — CID 68841797
1-[4-[[[(1R)-1-(3-methoxyphenyl)ethyl]amino]methyl]phenyl]-1-phenylpropan-2-amine (PubChem CID 68841797) has the molecular formula C25H30N2O and a molecular weight of 374.53 g/mol. Its IUPAC name is 1-[4-[[[(1R)-1-(3-methoxyphenyl)ethyl]amino]methyl]phenyl]-1-phenylpropan-2-amine.
| Compound Name | 1-[4-[[[(1R)-1-(3-methoxyphenyl)ethyl]amino]methyl]phenyl]-1-phenylpropan-2-amine |
|---|---|
| PubChem CID | 68841797 |
| Molecular Formula | C25H30N2O |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | 1-[4-[[[(1R)-1-(3-methoxyphenyl)ethyl]amino]methyl]phenyl]-1-phenylpropan-2-amine |
| SMILES | COc1cccc([C@@H](C)NCc2ccc(C(c3ccccc3)C(C)N)cc2)c1 |
| InChI | InChI=1S/C25H30N2O/c1-18(26)25(21-8-5-4-6-9-21)22-14-12-20(13-15-22)17-27-19(2)23-10-7-11-24(16-23)28-3/h4-16,18-19,25,27H,17,26H2,1-3H3/t18?,19-,25?/m1/s1 |
| InChIKey | LSKCGFKENYIFLP-FAFRJYIDSA-N |
| XLogP | 5.03 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |