C41H41N5O4S — CID 68842792
1-benzhydryl-4-[(E)-3-phenylprop-2-enyl]piperazine;4-hydroxy-2-methyl-1,1-dioxo-N-pyridin-2-yl-1λ6,2-benzothiazine-3-carboxamide (PubChem CID 68842792) has the molecular formula C41H41N5O4S and a molecular weight of 699.88 g/mol. Its IUPAC name is 1-benzhydryl-4-[(E)-3-phenylprop-2-enyl]piperazine;4-hydroxy-2-methyl-1,1-dioxo-N-pyridin-2-yl-1λ6,2-benzothiazine-3-carboxamide.
| Compound Name | 1-benzhydryl-4-[(E)-3-phenylprop-2-enyl]piperazine;4-hydroxy-2-methyl-1,1-dioxo-N-pyridin-2-yl-1λ6,2-benzothiazine-3-carboxamide |
|---|---|
| PubChem CID | 68842792 |
| Molecular Formula | C41H41N5O4S |
| Molecular Weight | 699.88 g/mol |
| Exact Mass | 699.29 |
| IUPAC Name | 1-benzhydryl-4-[(E)-3-phenylprop-2-enyl]piperazine;4-hydroxy-2-methyl-1,1-dioxo-N-pyridin-2-yl-1λ6,2-benzothiazine-3-carboxamide |
| SMILES | C(=C/c1ccccc1)\CN1CCN(C(c2ccccc2)c2ccccc2)CC1.CN1C(C(=O)Nc2ccccn2)=C(O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C26H28N2.C15H13N3O4S/c1-4-11-23(12-5-1)13-10-18-27-19-21-28(22-20-27)26(24-14-6-2-7-15-24)25-16-8-3-9-17-25;1-18-13(15(20)17-12-8-4-5-9-16-12)14(19)10-6-2-3-7-11(10)23(18,21)22/h1-17,26H,18-22H2;2-9,19H,1H3,(H,16,17,20)/b13-10+; |
| InChIKey | NEAQBNVZWVZFRJ-RSGUCCNWSA-N |
| XLogP | 6.69 |
| TPSA | 106.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.88 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |