C16H15N3O6S2 — CID 12802650
[2-methyl-1,1-dioxo-3-(pyridin-2-ylcarbamoyl)-1λ6,2-benzothiazin-4-yl] methanesulfonate (PubChem CID 12802650) has the molecular formula C16H15N3O6S2 and a molecular weight of 409.45 g/mol. Its IUPAC name is [2-methyl-1,1-dioxo-3-(pyridin-2-ylcarbamoyl)-1λ6,2-benzothiazin-4-yl] methanesulfonate.
| Compound Name | [2-methyl-1,1-dioxo-3-(pyridin-2-ylcarbamoyl)-1λ6,2-benzothiazin-4-yl] methanesulfonate |
|---|---|
| PubChem CID | 12802650 |
| Molecular Formula | C16H15N3O6S2 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | [2-methyl-1,1-dioxo-3-(pyridin-2-ylcarbamoyl)-1λ6,2-benzothiazin-4-yl] methanesulfonate |
| SMILES | CN1C(C(=O)Nc2ccccn2)=C(OS(C)(=O)=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C16H15N3O6S2/c1-19-14(16(20)18-13-9-5-6-10-17-13)15(25-26(2,21)22)11-7-3-4-8-12(11)27(19,23)24/h3-10H,1-2H3,(H,17,18,20) |
| InChIKey | PDWDXNAEXOBXNB-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 122.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|