C24H21N3O6S — CID 151578136
[2-[[2-methyl-1,1-dioxo-3-(pyridin-2-ylcarbamoyl)-1λ6,2-benzothiazin-4-yl]oxymethyl]phenyl] acetate (PubChem CID 151578136) has the molecular formula C24H21N3O6S and a molecular weight of 479.51 g/mol. Its IUPAC name is [2-[[2-methyl-1,1-dioxo-3-(pyridin-2-ylcarbamoyl)-1λ6,2-benzothiazin-4-yl]oxymethyl]phenyl] acetate.
| Compound Name | [2-[[2-methyl-1,1-dioxo-3-(pyridin-2-ylcarbamoyl)-1λ6,2-benzothiazin-4-yl]oxymethyl]phenyl] acetate |
|---|---|
| PubChem CID | 151578136 |
| Molecular Formula | C24H21N3O6S |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | [2-[[2-methyl-1,1-dioxo-3-(pyridin-2-ylcarbamoyl)-1λ6,2-benzothiazin-4-yl]oxymethyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1COC1=C(C(=O)Nc2ccccn2)N(C)S(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C24H21N3O6S/c1-16(28)33-19-11-5-3-9-17(19)15-32-23-18-10-4-6-12-20(18)34(30,31)27(2)22(23)24(29)26-21-13-7-8-14-25-21/h3-14H,15H2,1-2H3,(H,25,26,29) |
| InChIKey | QFXBMSNBSXLXJX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|