C13H10BrN3O4S2 — CID 54717105
6-bromo-4-hydroxy-2-methyl-1,1-dioxo-N-pyridin-2-ylthieno[2,3-e]thiazine-3-carboxamide (PubChem CID 54717105) has the molecular formula C13H10BrN3O4S2 and a molecular weight of 416.28 g/mol. Its IUPAC name is 6-bromo-4-hydroxy-2-methyl-1,1-dioxo-N-pyridin-2-ylthieno[2,3-e]thiazine-3-carboxamide.
| Compound Name | 6-bromo-4-hydroxy-2-methyl-1,1-dioxo-N-pyridin-2-ylthieno[2,3-e]thiazine-3-carboxamide |
|---|---|
| PubChem CID | 54717105 |
| Molecular Formula | C13H10BrN3O4S2 |
| Molecular Weight | 416.28 g/mol |
| Exact Mass | 414.93 |
| IUPAC Name | 6-bromo-4-hydroxy-2-methyl-1,1-dioxo-N-pyridin-2-ylthieno[2,3-e]thiazine-3-carboxamide |
| SMILES | CN1C(C(=O)Nc2ccccn2)=C(O)c2sc(Br)cc2S1(=O)=O |
| InChI | InChI=1S/C13H10BrN3O4S2/c1-17-10(13(19)16-9-4-2-3-5-15-9)11(18)12-7(23(17,20)21)6-8(14)22-12/h2-6,18H,1H3,(H,15,16,19) |
| InChIKey | KYZYXLMNKITJME-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |