C15H19N3O4S2 — CID 91365413
ethane;4-hydroxy-2-methyl-1,1-dioxo-N-pyridin-2-yl-4a,7a-dihydrothieno[2,3-e]thiazine-3-carboxamide (PubChem CID 91365413) has the molecular formula C15H19N3O4S2 and a molecular weight of 369.47 g/mol. Its IUPAC name is ethane;4-hydroxy-2-methyl-1,1-dioxo-N-pyridin-2-yl-4a,7a-dihydrothieno[2,3-e]thiazine-3-carboxamide.
| Compound Name | ethane;4-hydroxy-2-methyl-1,1-dioxo-N-pyridin-2-yl-4a,7a-dihydrothieno[2,3-e]thiazine-3-carboxamide |
|---|---|
| PubChem CID | 91365413 |
| Molecular Formula | C15H19N3O4S2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | ethane;4-hydroxy-2-methyl-1,1-dioxo-N-pyridin-2-yl-4a,7a-dihydrothieno[2,3-e]thiazine-3-carboxamide |
| SMILES | CC.CN1C(C(=O)Nc2ccccn2)=C(O)C2SC=CC2S1(=O)=O |
| InChI | InChI=1S/C13H13N3O4S2.C2H6/c1-16-10(13(18)15-9-4-2-3-6-14-9)11(17)12-8(5-7-21-12)22(16,19)20;1-2/h2-8,12,17H,1H3,(H,14,15,18);1-2H3 |
| InChIKey | LKHAWXKJXJWQTI-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |