C14H10F3N3O4S2 — CID 54677412
4-hydroxy-2-methyl-1,1-dioxo-N-pyridin-2-yl-6-(trifluoromethyl)thieno[2,3-e]thiazine-3-carboxamide (PubChem CID 54677412) has the molecular formula C14H10F3N3O4S2 and a molecular weight of 405.38 g/mol. Its IUPAC name is 4-hydroxy-2-methyl-1,1-dioxo-N-pyridin-2-yl-6-(trifluoromethyl)thieno[2,3-e]thiazine-3-carboxamide.
| Compound Name | 4-hydroxy-2-methyl-1,1-dioxo-N-pyridin-2-yl-6-(trifluoromethyl)thieno[2,3-e]thiazine-3-carboxamide |
|---|---|
| PubChem CID | 54677412 |
| Molecular Formula | C14H10F3N3O4S2 |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 405.01 |
| IUPAC Name | 4-hydroxy-2-methyl-1,1-dioxo-N-pyridin-2-yl-6-(trifluoromethyl)thieno[2,3-e]thiazine-3-carboxamide |
| SMILES | CN1C(C(=O)Nc2ccccn2)=C(O)c2sc(C(F)(F)F)cc2S1(=O)=O |
| InChI | InChI=1S/C14H10F3N3O4S2/c1-20-10(13(22)19-9-4-2-3-5-18-9)11(21)12-7(26(20,23)24)6-8(25-12)14(15,16)17/h2-6,21H,1H3,(H,18,19,22) |
| InChIKey | FHZDNBBQTQLLLV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |