C17H17ClN4O7S2 — CID 87881345
1-[6-chloro-2-methyl-1,1-dioxo-3-(pyridin-2-ylcarbamoyl)thieno[2,3-e]thiazin-4-yl]oxyethyl N-methoxycarbamate (PubChem CID 87881345) has the molecular formula C17H17ClN4O7S2 and a molecular weight of 488.93 g/mol. Its IUPAC name is 1-[6-chloro-2-methyl-1,1-dioxo-3-(pyridin-2-ylcarbamoyl)thieno[2,3-e]thiazin-4-yl]oxyethyl N-methoxycarbamate.
| Compound Name | 1-[6-chloro-2-methyl-1,1-dioxo-3-(pyridin-2-ylcarbamoyl)thieno[2,3-e]thiazin-4-yl]oxyethyl N-methoxycarbamate |
|---|---|
| PubChem CID | 87881345 |
| Molecular Formula | C17H17ClN4O7S2 |
| Molecular Weight | 488.93 g/mol |
| Exact Mass | 488.02 |
| IUPAC Name | 1-[6-chloro-2-methyl-1,1-dioxo-3-(pyridin-2-ylcarbamoyl)thieno[2,3-e]thiazin-4-yl]oxyethyl N-methoxycarbamate |
| SMILES | CONC(=O)OC(C)OC1=C(C(=O)Nc2ccccn2)N(C)S(=O)(=O)c2cc(Cl)sc21 |
| InChI | InChI=1S/C17H17ClN4O7S2/c1-9(29-17(24)21-27-3)28-14-13(16(23)20-12-6-4-5-7-19-12)22(2)31(25,26)10-8-11(18)30-15(10)14/h4-9H,1-3H3,(H,21,24)(H,19,20,23) |
| InChIKey | DXZMUXROOBHHLS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 136.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.93 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|