C21H21N3O4 — CID 68849264
(5-nitro-3-phenyl-1H-indol-2-yl) N-cyclohexylcarbamate (PubChem CID 68849264) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is (5-nitro-3-phenyl-1H-indol-2-yl) N-cyclohexylcarbamate.
| Compound Name | (5-nitro-3-phenyl-1H-indol-2-yl) N-cyclohexylcarbamate |
|---|---|
| PubChem CID | 68849264 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | (5-nitro-3-phenyl-1H-indol-2-yl) N-cyclohexylcarbamate |
| SMILES | O=C(NC1CCCCC1)Oc1[nH]c2ccc([N+](=O)[O-])cc2c1-c1ccccc1 |
| InChI | InChI=1S/C21H21N3O4/c25-21(22-15-9-5-2-6-10-15)28-20-19(14-7-3-1-4-8-14)17-13-16(24(26)27)11-12-18(17)23-20/h1,3-4,7-8,11-13,15,23H,2,5-6,9-10H2,(H,22,25) |
| InChIKey | NYCGNQXBPQRJQM-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 97.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|